C25H24F3NO3 — CID 60571880
2-naphthalen-2-yloxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]acetamide (PubChem CID 60571880) has the molecular formula C25H24F3NO3 and a molecular weight of 443.47 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]acetamide.
| Compound Name | 2-naphthalen-2-yloxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 60571880 |
| Molecular Formula | C25H24F3NO3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-naphthalen-2-yloxy-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C25H24F3NO3/c26-25(27,28)21-7-3-6-20(15-21)24(10-12-31-13-11-24)17-29-23(30)16-32-22-9-8-18-4-1-2-5-19(18)14-22/h1-9,14-15H,10-13,16-17H2,(H,29,30) |
| InChIKey | DZDZVSWDDWUBNU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |