C18H21NO4 — CID 56765194
N-[(4-hydroxyoxan-4-yl)methyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 56765194) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 56765194 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C18H21NO4/c20-17(19-13-18(21)7-9-22-10-8-18)12-23-16-6-5-14-3-1-2-4-15(14)11-16/h1-6,11,21H,7-10,12-13H2,(H,19,20) |
| InChIKey | SHXBYLRYUONCIO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |