C20H27ClN2O3 — CID 120890968
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-naphthalen-2-yloxyacetamide;hydrochloride (PubChem CID 120890968) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-naphthalen-2-yloxyacetamide;hydrochloride.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-naphthalen-2-yloxyacetamide;hydrochloride |
|---|---|
| PubChem CID | 120890968 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-naphthalen-2-yloxyacetamide;hydrochloride |
| SMILES | COCC1(CNC(=O)COc2ccc3ccccc3c2)CCNCC1.Cl |
| InChI | InChI=1S/C20H26N2O3.ClH/c1-24-15-20(8-10-21-11-9-20)14-22-19(23)13-25-18-7-6-16-4-2-3-5-17(16)12-18;/h2-7,12,21H,8-11,13-15H2,1H3,(H,22,23);1H |
| InChIKey | ZMNUNULKFZEAFQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |