C23H30N2O2 — CID 120888993
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3,3-diphenylpropanamide (PubChem CID 120888993) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3,3-diphenylpropanamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 120888993 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3,3-diphenylpropanamide |
| SMILES | COCC1(CNC(=O)CC(c2ccccc2)c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C23H30N2O2/c1-27-18-23(12-14-24-15-13-23)17-25-22(26)16-21(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,21,24H,12-18H2,1H3,(H,25,26) |
| InChIKey | AAWXOFTVMDXYLX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |