C19H30N2O2 — CID 120888204
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-methyl-3-phenylbutanamide (PubChem CID 120888204) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-methyl-3-phenylbutanamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 120888204 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-methyl-3-phenylbutanamide |
| SMILES | COCC1(CNC(=O)CC(C)(C)c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-18(2,16-7-5-4-6-8-16)13-17(22)21-14-19(15-23-3)9-11-20-12-10-19/h4-8,20H,9-15H2,1-3H3,(H,21,22) |
| InChIKey | OKVBRPUROZWERT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |