C18H27ClN2O3S — CID 120892025
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-phenacylsulfanylacetamide;hydrochloride (PubChem CID 120892025) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-phenacylsulfanylacetamide;hydrochloride.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-phenacylsulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120892025 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-phenacylsulfanylacetamide;hydrochloride |
| SMILES | COCC1(CNC(=O)CSCC(=O)c2ccccc2)CCNCC1.Cl |
| InChI | InChI=1S/C18H26N2O3S.ClH/c1-23-14-18(7-9-19-10-8-18)13-20-17(22)12-24-11-16(21)15-5-3-2-4-6-15;/h2-6,19H,7-14H2,1H3,(H,20,22);1H |
| InChIKey | HNRCMXOTMAKOCE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |