C20H32N2O3 — CID 120891684
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-propoxyphenyl)propanamide (PubChem CID 120891684) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-propoxyphenyl)propanamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-propoxyphenyl)propanamide |
|---|---|
| PubChem CID | 120891684 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-propoxyphenyl)propanamide |
| SMILES | CCCOc1ccc(CCC(=O)NCC2(COC)CCNCC2)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-3-14-25-18-7-4-17(5-8-18)6-9-19(23)22-15-20(16-24-2)10-12-21-13-11-20/h4-5,7-8,21H,3,6,9-16H2,1-2H3,(H,22,23) |
| InChIKey | BGYGIEAJZDDQCZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |