C19H25F3N2O2 — CID 94656629
1-[(1S)-1-cyclopropylethyl]-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]urea (PubChem CID 94656629) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-[(1S)-1-cyclopropylethyl]-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]urea.
| Compound Name | 1-[(1S)-1-cyclopropylethyl]-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]urea |
|---|---|
| PubChem CID | 94656629 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[(1S)-1-cyclopropylethyl]-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]urea |
| SMILES | C[C@H](NC(=O)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1)C1CC1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-13(14-5-6-14)24-17(25)23-12-18(7-9-26-10-8-18)15-3-2-4-16(11-15)19(20,21)22/h2-4,11,13-14H,5-10,12H2,1H3,(H2,23,24,25)/t13-/m0/s1 |
| InChIKey | JVJXIILMDBTEEA-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |