C20H27F3N2O2 — CID 119749716
3-amino-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 119749716) has the molecular formula C20H27F3N2O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-amino-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119749716 |
| Molecular Formula | C20H27F3N2O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-amino-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)NCC2(c3cccc(C(F)(F)F)c3)CCOCC2)C1 |
| InChI | InChI=1S/C20H27F3N2O2/c21-20(22,23)16-5-2-4-15(12-16)19(7-9-27-10-8-19)13-25-18(26)14-3-1-6-17(24)11-14/h2,4-5,12,14,17H,1,3,6-11,13,24H2,(H,25,26) |
| InChIKey | QSMVJCULZIVOBY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |