C19H28BrClN2O2 — CID 119768583
3-amino-N-[[4-(4-bromophenyl)oxan-4-yl]methyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119768583) has the molecular formula C19H28BrClN2O2 and a molecular weight of 431.80 g/mol. Its IUPAC name is 3-amino-N-[[4-(4-bromophenyl)oxan-4-yl]methyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[[4-(4-bromophenyl)oxan-4-yl]methyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119768583 |
| Molecular Formula | C19H28BrClN2O2 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-amino-N-[[4-(4-bromophenyl)oxan-4-yl]methyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)NCC2(c3ccc(Br)cc3)CCOCC2)C1 |
| InChI | InChI=1S/C19H27BrN2O2.ClH/c20-16-6-4-15(5-7-16)19(8-10-24-11-9-19)13-22-18(23)14-2-1-3-17(21)12-14;/h4-7,14,17H,1-3,8-13,21H2,(H,22,23);1H |
| InChIKey | YPDFXNUSVXVJQU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |