C18H25BrN2O2 — CID 119314892
N-[[4-(4-bromophenyl)oxan-4-yl]methyl]piperidine-2-carboxamide (PubChem CID 119314892) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)oxan-4-yl]methyl]piperidine-2-carboxamide.
| Compound Name | N-[[4-(4-bromophenyl)oxan-4-yl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119314892 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[[4-(4-bromophenyl)oxan-4-yl]methyl]piperidine-2-carboxamide |
| SMILES | O=C(NCC1(c2ccc(Br)cc2)CCOCC1)C1CCCCN1 |
| InChI | InChI=1S/C18H25BrN2O2/c19-15-6-4-14(5-7-15)18(8-11-23-12-9-18)13-21-17(22)16-3-1-2-10-20-16/h4-7,16,20H,1-3,8-13H2,(H,21,22) |
| InChIKey | MZHMGRSJMVDQDH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |