C21H29F3N2O2 — CID 126770138
1-ethyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]piperidine-2-carboxamide (PubChem CID 126770138) has the molecular formula C21H29F3N2O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-ethyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]piperidine-2-carboxamide.
| Compound Name | 1-ethyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 126770138 |
| Molecular Formula | C21H29F3N2O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-ethyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]piperidine-2-carboxamide |
| SMILES | CCN1CCCCC1C(=O)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C21H29F3N2O2/c1-2-26-11-4-3-8-18(26)19(27)25-15-20(9-12-28-13-10-20)16-6-5-7-17(14-16)21(22,23)24/h5-7,14,18H,2-4,8-13,15H2,1H3,(H,25,27) |
| InChIKey | QVBRSUBKBMNDHQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |