C19H22F3NO — CID 56575500
(4-methylidenepiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanone (PubChem CID 56575500) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is (4-methylidenepiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanone.
| Compound Name | (4-methylidenepiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanone |
|---|---|
| PubChem CID | 56575500 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (4-methylidenepiperidin-1-yl)-[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methanone |
| SMILES | C=C1CCN(C(=O)C2(c3cccc(C(F)(F)F)c3)CCCC2)CC1 |
| InChI | InChI=1S/C19H22F3NO/c1-14-7-11-23(12-8-14)17(24)18(9-2-3-10-18)15-5-4-6-16(13-15)19(20,21)22/h4-6,13H,1-3,7-12H2 |
| InChIKey | JLHYZJHLURVENV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|