C22H29F3N2O2 — CID 47088076
N-propyl-1-[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]piperidine-3-carboxamide (PubChem CID 47088076) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-propyl-1-[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]piperidine-3-carboxamide.
| Compound Name | N-propyl-1-[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47088076 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-propyl-1-[1-[3-(trifluoromethyl)phenyl]cyclopentanecarbonyl]piperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(C(=O)C2(c3cccc(C(F)(F)F)c3)CCCC2)C1 |
| InChI | InChI=1S/C22H29F3N2O2/c1-2-12-26-19(28)16-7-6-13-27(15-16)20(29)21(10-3-4-11-21)17-8-5-9-18(14-17)22(23,24)25/h5,8-9,14,16H,2-4,6-7,10-13,15H2,1H3,(H,26,28) |
| InChIKey | NCMWCOCANUWCHG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |