C16H17F3O3 — CID 102558626
oxolan-3-yl 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylate (PubChem CID 102558626) has the molecular formula C16H17F3O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is oxolan-3-yl 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylate.
| Compound Name | oxolan-3-yl 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 102558626 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | oxolan-3-yl 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylate |
| SMILES | O=C(OC1CCOC1)C1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C16H17F3O3/c17-16(18,19)12-4-1-3-11(9-12)15(6-2-7-15)14(20)22-13-5-8-21-10-13/h1,3-4,9,13H,2,5-8,10H2 |
| InChIKey | YLFDUNUOJZHHHF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |