C16H13F3O4 — CID 86897204
oxolan-3-yl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate (PubChem CID 86897204) has the molecular formula C16H13F3O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is oxolan-3-yl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate.
| Compound Name | oxolan-3-yl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 86897204 |
| Molecular Formula | C16H13F3O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | oxolan-3-yl 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
| SMILES | O=C(OC1CCOC1)c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H13F3O4/c17-16(18,19)11-3-1-2-10(8-11)13-4-5-14(23-13)15(20)22-12-6-7-21-9-12/h1-5,8,12H,6-7,9H2 |
| InChIKey | ROXKFWGIVGFKLX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |