C14H15F3O4 — CID 166323892
[3-(trifluoromethyl)phenyl]methyl 2-[(3S)-oxolan-3-yl]oxyacetate (PubChem CID 166323892) has the molecular formula C14H15F3O4 and a molecular weight of 304.26 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 2-[(3S)-oxolan-3-yl]oxyacetate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 2-[(3S)-oxolan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 166323892 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 2-[(3S)-oxolan-3-yl]oxyacetate |
| SMILES | O=C(CO[C@H]1CCOC1)OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3O4/c15-14(16,17)11-3-1-2-10(6-11)7-21-13(18)9-20-12-4-5-19-8-12/h1-3,6,12H,4-5,7-9H2/t12-/m0/s1 |
| InChIKey | WDNROBBNMQUHDH-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |