C19H18F3NO5 — CID 42893729
(1-morpholin-4-yl-1-oxopropan-2-yl) 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate (PubChem CID 42893729) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is (1-morpholin-4-yl-1-oxopropan-2-yl) 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate.
| Compound Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 42893729 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 5-[3-(trifluoromethyl)phenyl]furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H18F3NO5/c1-12(17(24)23-7-9-26-10-8-23)27-18(25)16-6-5-15(28-16)13-3-2-4-14(11-13)19(20,21)22/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | KMUXDEPHTHSGEY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |