C19H20FNO6 — CID 31836704
[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate (PubChem CID 31836704) has the molecular formula C19H20FNO6 and a molecular weight of 377.37 g/mol. Its IUPAC name is [(2S)-1-morpholin-4-yl-1-oxopropan-2-yl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [(2S)-1-morpholin-4-yl-1-oxopropan-2-yl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 31836704 |
| Molecular Formula | C19H20FNO6 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(2S)-1-morpholin-4-yl-1-oxopropan-2-yl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc(COc2ccc(F)cc2)o1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H20FNO6/c1-13(18(22)21-8-10-24-11-9-21)26-19(23)17-7-6-16(27-17)12-25-15-4-2-14(20)3-5-15/h2-7,13H,8-12H2,1H3/t13-/m0/s1 |
| InChIKey | RYDFQRVVFDGJJG-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |