C23H31FN2O4 — CID 46529402
N-(3-ethyl-2-morpholin-4-ylpentyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 46529402) has the molecular formula C23H31FN2O4 and a molecular weight of 418.51 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46529402 |
| Molecular Formula | C23H31FN2O4 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)c1ccc(COc2ccc(F)cc2)o1)N1CCOCC1 |
| InChI | InChI=1S/C23H31FN2O4/c1-3-17(4-2)21(26-11-13-28-14-12-26)15-25-23(27)22-10-9-20(30-22)16-29-19-7-5-18(24)6-8-19/h5-10,17,21H,3-4,11-16H2,1-2H3,(H,25,27) |
| InChIKey | AJZOSMDSWRAYCD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |