C17H16FN3O3 — CID 19292297
5-[(4-fluorophenoxy)methyl]-N-[(1-methylpyrazol-4-yl)methyl]furan-2-carboxamide (PubChem CID 19292297) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[(1-methylpyrazol-4-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[(1-methylpyrazol-4-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19292297 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[(1-methylpyrazol-4-yl)methyl]furan-2-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2ccc(COc3ccc(F)cc3)o2)cn1 |
| InChI | InChI=1S/C17H16FN3O3/c1-21-10-12(9-20-21)8-19-17(22)16-7-6-15(24-16)11-23-14-4-2-13(18)3-5-14/h2-7,9-10H,8,11H2,1H3,(H,19,22) |
| InChIKey | MFSCZZQTUCTTES-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |