C31H26F3NO3S — CID 162414046
(3R)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-2,6-dihydropyridin-3-ol (PubChem CID 162414046) has the molecular formula C31H26F3NO3S and a molecular weight of 549.61 g/mol. Its IUPAC name is (3R)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-2,6-dihydropyridin-3-ol.
| Compound Name | (3R)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-2,6-dihydropyridin-3-ol |
|---|---|
| PubChem CID | 162414046 |
| Molecular Formula | C31H26F3NO3S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (3R)-1-(4-methylphenyl)sulfonyl-4,5-diphenyl-3-[3-(trifluoromethyl)phenyl]-2,6-dihydropyridin-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)=C(c3ccccc3)[C@](O)(c3cccc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C31H26F3NO3S/c1-22-15-17-27(18-16-22)39(37,38)35-20-28(23-9-4-2-5-10-23)29(24-11-6-3-7-12-24)30(36,21-35)25-13-8-14-26(19-25)31(32,33)34/h2-19,36H,20-21H2,1H3/t30-/m1/s1 |
| InChIKey | MJPAERPUNSDIQO-SSEXGKCCSA-N |
| XLogP | 6.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|