C11H10F3NO4S — CID 70663656
3-(azetidin-1-ylsulfonyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 70663656) has the molecular formula C11H10F3NO4S and a molecular weight of 309.27 g/mol. Its IUPAC name is 3-(azetidin-1-ylsulfonyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(azetidin-1-ylsulfonyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 70663656 |
| Molecular Formula | C11H10F3NO4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-(azetidin-1-ylsulfonyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc(S(=O)(=O)N2CCC2)c1 |
| InChI | InChI=1S/C11H10F3NO4S/c12-11(13,14)8-4-7(10(16)17)5-9(6-8)20(18,19)15-2-1-3-15/h4-6H,1-3H2,(H,16,17) |
| InChIKey | HNQXFNVGFYOHID-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |