C12H14BrF3N2O2S — CID 68630923
1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine (PubChem CID 68630923) has the molecular formula C12H14BrF3N2O2S and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine.
| Compound Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 68630923 |
| Molecular Formula | C12H14BrF3N2O2S |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H14BrF3N2O2S/c1-17-2-4-18(5-3-17)21(19,20)11-7-9(12(14,15)16)6-10(13)8-11/h6-8H,2-5H2,1H3 |
| InChIKey | XLBCOTFOXZLQOL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |