C16H20F6N2O3S — CID 78821056
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-ethoxyethyl)piperazine (PubChem CID 78821056) has the molecular formula C16H20F6N2O3S and a molecular weight of 434.40 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-ethoxyethyl)piperazine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-ethoxyethyl)piperazine |
|---|---|
| PubChem CID | 78821056 |
| Molecular Formula | C16H20F6N2O3S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-ethoxyethyl)piperazine |
| SMILES | CCOCCN1CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H20F6N2O3S/c1-2-27-8-7-23-3-5-24(6-4-23)28(25,26)14-10-12(15(17,18)19)9-13(11-14)16(20,21)22/h9-11H,2-8H2,1H3 |
| InChIKey | WBVVFUHXSUQEBC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|