C11H11BrF3NO3S — CID 121414220
(3R)-1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol (PubChem CID 121414220) has the molecular formula C11H11BrF3NO3S and a molecular weight of 374.18 g/mol. Its IUPAC name is (3R)-1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 121414220 |
| Molecular Formula | C11H11BrF3NO3S |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | (3R)-1-[3-bromo-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1cc(Br)cc(C(F)(F)F)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H11BrF3NO3S/c12-8-3-7(11(13,14)15)4-10(5-8)20(18,19)16-2-1-9(17)6-16/h3-5,9,17H,1-2,6H2/t9-/m1/s1 |
| InChIKey | DBEIQXBBGDSFAW-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |