C15H17F3N2O3S — CID 138506245
N-[3-piperidin-1-ylsulfonyl-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 138506245) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[3-piperidin-1-ylsulfonyl-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-piperidin-1-ylsulfonyl-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138506245 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[3-piperidin-1-ylsulfonyl-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C(F)(F)F)cc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C15H17F3N2O3S/c1-2-14(21)19-12-8-11(15(16,17)18)9-13(10-12)24(22,23)20-6-4-3-5-7-20/h2,8-10H,1,3-7H2,(H,19,21) |
| InChIKey | PKKOBYXHFUTWKS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|