C14H14ClF2N3O — CID 83072874
2-N-(2-chloro-4,6-difluorophenyl)-6-propoxypyridine-2,5-diamine (PubChem CID 83072874) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-N-(2-chloro-4,6-difluorophenyl)-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-(2-chloro-4,6-difluorophenyl)-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 83072874 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-N-(2-chloro-4,6-difluorophenyl)-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(Nc2c(F)cc(F)cc2Cl)ccc1N |
| InChI | InChI=1S/C14H14ClF2N3O/c1-2-5-21-14-11(18)3-4-12(20-14)19-13-9(15)6-8(16)7-10(13)17/h3-4,6-7H,2,5,18H2,1H3,(H,19,20) |
| InChIKey | FJDINTADSZLSAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |