C15H15ClN4O — CID 107807065
4-[(5-amino-6-propoxy-2-pyridinyl)amino]-3-chlorobenzonitrile (PubChem CID 107807065) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is 4-[(5-amino-6-propoxy-2-pyridinyl)amino]-3-chlorobenzonitrile.
| Compound Name | 4-[(5-amino-6-propoxy-2-pyridinyl)amino]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 107807065 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[(5-amino-6-propoxy-2-pyridinyl)amino]-3-chlorobenzonitrile |
| SMILES | CCCOc1nc(Nc2ccc(C#N)cc2Cl)ccc1N |
| InChI | InChI=1S/C15H15ClN4O/c1-2-7-21-15-12(18)4-6-14(20-15)19-13-5-3-10(9-17)8-11(13)16/h3-6,8H,2,7,18H2,1H3,(H,19,20) |
| InChIKey | OGEIIMDKDHVJBX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |