C14H13BrN4O — CID 107787248
4-[(5-amino-6-ethoxy-2-pyridinyl)amino]-3-bromobenzonitrile (PubChem CID 107787248) has the molecular formula C14H13BrN4O and a molecular weight of 333.19 g/mol. Its IUPAC name is 4-[(5-amino-6-ethoxy-2-pyridinyl)amino]-3-bromobenzonitrile.
| Compound Name | 4-[(5-amino-6-ethoxy-2-pyridinyl)amino]-3-bromobenzonitrile |
|---|---|
| PubChem CID | 107787248 |
| Molecular Formula | C14H13BrN4O |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 4-[(5-amino-6-ethoxy-2-pyridinyl)amino]-3-bromobenzonitrile |
| SMILES | CCOc1nc(Nc2ccc(C#N)cc2Br)ccc1N |
| InChI | InChI=1S/C14H13BrN4O/c1-2-20-14-11(17)4-6-13(19-14)18-12-5-3-9(8-16)7-10(12)15/h3-7H,2,17H2,1H3,(H,18,19) |
| InChIKey | NMLHMCRXECPLPT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |