C15H18BrN3O — CID 43805886
2-N-(5-bromo-2-methylphenyl)-6-propoxypyridine-2,5-diamine (PubChem CID 43805886) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-N-(5-bromo-2-methylphenyl)-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-(5-bromo-2-methylphenyl)-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 43805886 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-N-(5-bromo-2-methylphenyl)-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(Nc2cc(Br)ccc2C)ccc1N |
| InChI | InChI=1S/C15H18BrN3O/c1-3-8-20-15-12(17)6-7-14(19-15)18-13-9-11(16)5-4-10(13)2/h4-7,9H,3,8,17H2,1-2H3,(H,18,19) |
| InChIKey | FNPBDQIMSKCQCY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |