About 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine
2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine (PubChem CID 28846305) has the molecular formula C12H12ClN3
and a molecular weight of 233.70 g/mol. Its IUPAC name is 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine |
| PubChem CID | 28846305 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine |
| SMILES | Cc1ccc(Cl)cc1Nc1ncccc1N |
| InChI | InChI=1S/C12H12ClN3/c1-8-4-5-9(13)7-11(8)16-12-10(14)3-2-6-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | MNCLVZRBHHTKNH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine?
The IUPAC name of 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine (CID 28846305) is 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine.
What is the SMILES notation for 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine?
The canonical SMILES for 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine is Cc1ccc(Cl)cc1Nc1ncccc1N.
What is the InChIKey of 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine?
The InChIKey is MNCLVZRBHHTKNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3/c1-8-4-5-9(13)7-11(8)16-12-10(14)3-2-6-15-12/h2-7H,14H2,1H3,(H,15,16).
What are the key properties of 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine?
2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine has a molecular weight of 233.70 g/mol, XLogP of 3.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(5-chloro-2-methylphenyl)pyridine-2,3-diamine is sourced from PubChem (CID 28846305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).