C13H14ClN3O — CID 28846412
2-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-2,3-diamine (PubChem CID 28846412) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 2-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-2,3-diamine.
| Compound Name | 2-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 28846412 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-N-(4-chloro-2-methoxy-5-methylphenyl)pyridine-2,3-diamine |
| SMILES | COc1cc(Cl)c(C)cc1Nc1ncccc1N |
| InChI | InChI=1S/C13H14ClN3O/c1-8-6-11(12(18-2)7-9(8)14)17-13-10(15)4-3-5-16-13/h3-7H,15H2,1-2H3,(H,16,17) |
| InChIKey | YMRBSEXOWCUCMW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |