C23H21ClN6 — CID 22547240
4-N-(5-chloro-2-methylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 22547240) has the molecular formula C23H21ClN6 and a molecular weight of 416.92 g/mol. Its IUPAC name is 4-N-(5-chloro-2-methylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(5-chloro-2-methylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22547240 |
| Molecular Formula | C23H21ClN6 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-N-(5-chloro-2-methylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc(Cl)cc1Nc1ncnc(NN(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C23H21ClN6/c1-16-12-13-17(24)14-20(16)28-22-21(25)23(27-15-26-22)29-30(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,25H2,1H3,(H2,26,27,28,29) |
| InChIKey | ADYUDQWDOZJPBX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|