C24H24N6 — CID 22546221
4-N-(3,4-dimethylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 22546221) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3,4-dimethylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22546221 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-6-(2,2-diphenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc(Nc2ncnc(NN(c3ccccc3)c3ccccc3)c2N)cc1C |
| InChI | InChI=1S/C24H24N6/c1-17-13-14-19(15-18(17)2)28-23-22(25)24(27-16-26-23)29-30(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16H,25H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | KNVIDNPANBCNCT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|