C21H19N7 — CID 19145412
6-(2,2-diphenylhydrazinyl)-4-N-pyridin-3-ylpyrimidine-4,5-diamine (PubChem CID 19145412) has the molecular formula C21H19N7 and a molecular weight of 369.43 g/mol. Its IUPAC name is 6-(2,2-diphenylhydrazinyl)-4-N-pyridin-3-ylpyrimidine-4,5-diamine.
| Compound Name | 6-(2,2-diphenylhydrazinyl)-4-N-pyridin-3-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19145412 |
| Molecular Formula | C21H19N7 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6-(2,2-diphenylhydrazinyl)-4-N-pyridin-3-ylpyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2cccnc2)ncnc1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N7/c22-19-20(26-16-8-7-13-23-14-16)24-15-25-21(19)27-28(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-15H,22H2,(H2,24,25,26,27) |
| InChIKey | RGTCGYUNZMSZDG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|