C15H20FN3 — CID 83164439
7-fluoro-8-N-(4-methylpentan-2-yl)quinoline-5,8-diamine (PubChem CID 83164439) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 7-fluoro-8-N-(4-methylpentan-2-yl)quinoline-5,8-diamine.
| Compound Name | 7-fluoro-8-N-(4-methylpentan-2-yl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 83164439 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 7-fluoro-8-N-(4-methylpentan-2-yl)quinoline-5,8-diamine |
| SMILES | CC(C)CC(C)Nc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C15H20FN3/c1-9(2)7-10(3)19-15-12(16)8-13(17)11-5-4-6-18-14(11)15/h4-6,8-10,19H,7,17H2,1-3H3 |
| InChIKey | OGUXDKWOICXJOG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|