C14H18FN3O — CID 83164289
7-fluoro-8-N-(3-methoxy-2-methylpropyl)quinoline-5,8-diamine (PubChem CID 83164289) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 7-fluoro-8-N-(3-methoxy-2-methylpropyl)quinoline-5,8-diamine.
| Compound Name | 7-fluoro-8-N-(3-methoxy-2-methylpropyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 83164289 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 7-fluoro-8-N-(3-methoxy-2-methylpropyl)quinoline-5,8-diamine |
| SMILES | COCC(C)CNc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C14H18FN3O/c1-9(8-19-2)7-18-14-11(15)6-12(16)10-4-3-5-17-13(10)14/h3-6,9,18H,7-8,16H2,1-2H3 |
| InChIKey | NFCXIVVKBUUAQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|