C12H9F3O5 — CID 158268069
6-hydroxy-8-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 158268069) has the molecular formula C12H9F3O5 and a molecular weight of 290.19 g/mol. Its IUPAC name is 6-hydroxy-8-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-hydroxy-8-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 158268069 |
| Molecular Formula | C12H9F3O5 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 6-hydroxy-8-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COc1cc(O)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C12H9F3O5/c1-19-8-4-6(16)2-5-3-7(11(17)18)10(12(13,14)15)20-9(5)8/h2-4,10,16H,1H3,(H,17,18) |
| InChIKey | UJYIXOHNJNVQKG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |