C16H13F3O4 — CID 118067829
ethyl 8-(2-deuterioethynyl)-6-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118067829) has the molecular formula C16H13F3O4 and a molecular weight of 327.28 g/mol. Its IUPAC name is ethyl 8-(2-deuterioethynyl)-6-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 8-(2-deuterioethynyl)-6-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118067829 |
| Molecular Formula | C16H13F3O4 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl 8-(2-deuterioethynyl)-6-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | [2H]C#Cc1cc(OC)cc2c1OC(C(F)(F)F)C(C(=O)OCC)=C2 |
| InChI | InChI=1S/C16H13F3O4/c1-4-9-6-11(21-3)7-10-8-12(15(20)22-5-2)14(16(17,18)19)23-13(9)10/h1,6-8,14H,5H2,2-3H3/i1D |
| InChIKey | ZHWHTMMEMXNYEX-MICDWDOJSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|