C13H10F8O3S — CID 137412830
ethyl 7-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 137412830) has the molecular formula C13H10F8O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is ethyl 7-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 7-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 137412830 |
| Molecular Formula | C13H10F8O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | ethyl 7-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccc(S(F)(F)(F)(F)F)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C13H10F8O3S/c1-2-23-12(22)9-5-7-3-4-8(25(17,18,19,20)21)6-10(7)24-11(9)13(14,15)16/h3-6,11H,2H2,1H3 |
| InChIKey | DBAVUJKDDCUDDD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |