C14H11ClF3N3O3 — CID 86599453
ethyl 7-(azidomethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 86599453) has the molecular formula C14H11ClF3N3O3 and a molecular weight of 361.71 g/mol. Its IUPAC name is ethyl 7-(azidomethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 7-(azidomethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 86599453 |
| Molecular Formula | C14H11ClF3N3O3 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | ethyl 7-(azidomethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(Cl)c(CN=[N+]=[N-])cc2OC1C(F)(F)F |
| InChI | InChI=1S/C14H11ClF3N3O3/c1-2-23-13(22)9-3-7-4-10(15)8(6-20-21-19)5-11(7)24-12(9)14(16,17)18/h3-5,12H,2,6H2,1H3 |
| InChIKey | WFRLPCAOVZLTGI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|