C13H9ClF4O3 — CID 58934464
ethyl 6-chloro-5-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934464) has the molecular formula C13H9ClF4O3 and a molecular weight of 324.66 g/mol. Its IUPAC name is ethyl 6-chloro-5-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 6-chloro-5-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934464 |
| Molecular Formula | C13H9ClF4O3 |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | ethyl 6-chloro-5-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2c(ccc(Cl)c2F)OC1C(F)(F)F |
| InChI | InChI=1S/C13H9ClF4O3/c1-2-20-12(19)7-5-6-9(4-3-8(14)10(6)15)21-11(7)13(16,17)18/h3-5,11H,2H2,1H3 |
| InChIKey | DWLUYWNWFIIYMG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |