C19H14ClF3O4 — CID 58934759
ethyl 6-chloro-5-phenoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934759) has the molecular formula C19H14ClF3O4 and a molecular weight of 398.76 g/mol. Its IUPAC name is ethyl 6-chloro-5-phenoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 6-chloro-5-phenoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934759 |
| Molecular Formula | C19H14ClF3O4 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | ethyl 6-chloro-5-phenoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2c(ccc(Cl)c2Oc2ccccc2)OC1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3O4/c1-2-25-18(24)13-10-12-15(27-17(13)19(21,22)23)9-8-14(20)16(12)26-11-6-4-3-5-7-11/h3-10,17H,2H2,1H3 |
| InChIKey | SBVDVHDBVJEAPK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |