C19H18O5 — CID 10496344
diethyl 3H-benzo[f]chromene-2,3-dicarboxylate (PubChem CID 10496344) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is diethyl 3H-benzo[f]chromene-2,3-dicarboxylate.
| Compound Name | diethyl 3H-benzo[f]chromene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10496344 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | diethyl 3H-benzo[f]chromene-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=Cc2c(ccc3ccccc23)OC1C(=O)OCC |
| InChI | InChI=1S/C19H18O5/c1-3-22-18(20)15-11-14-13-8-6-5-7-12(13)9-10-16(14)24-17(15)19(21)23-4-2/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | OUHAVESOYFFXCD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |