C13H10ClF3O3 — CID 15458898
ethyl 6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 15458898) has the molecular formula C13H10ClF3O3 and a molecular weight of 306.67 g/mol. Its IUPAC name is ethyl 6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 15458898 |
| Molecular Formula | C13H10ClF3O3 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | ethyl 6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(Cl)ccc2OC1C(F)(F)F |
| InChI | InChI=1S/C13H10ClF3O3/c1-2-19-12(18)9-6-7-5-8(14)3-4-10(7)20-11(9)13(15,16)17/h3-6,11H,2H2,1H3 |
| InChIKey | YNUXNUIXJWXLAJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |