C16H14F6O5 — CID 91105278
4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 91105278) has the molecular formula C16H14F6O5 and a molecular weight of 400.27 g/mol. Its IUPAC name is 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 91105278 |
| Molecular Formula | C16H14F6O5 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OCCCCO)C1=Cc2cc(OC(F)(F)F)ccc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C16H14F6O5/c17-15(18,19)13-11(14(24)25-6-2-1-5-23)8-9-7-10(27-16(20,21)22)3-4-12(9)26-13/h3-4,7-8,13,23H,1-2,5-6H2/t13-/m0/s1 |
| InChIKey | CIKYCAWRPDUSRU-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|