About 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate
4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 91105278) has the molecular formula C16H14F6O5
and a molecular weight of 400.27 g/mol. Its IUPAC name is 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
Molecular Properties
| Compound Name | 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| PubChem CID | 91105278 |
| Molecular Formula | C16H14F6O5 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OCCCCO)C1=Cc2cc(OC(F)(F)F)ccc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C16H14F6O5/c17-15(18,19)13-11(14(24)25-6-2-1-5-23)8-9-7-10(27-16(20,21)22)3-4-12(9)26-13/h3-4,7-8,13,23H,1-2,5-6H2/t13-/m0/s1 |
| InChIKey | CIKYCAWRPDUSRU-ZDUSSCGKSA-N |
| XLogP | 3.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The IUPAC name of 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (CID 91105278) is 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
What is the SMILES notation for 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The canonical SMILES for 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate is O=C(OCCCCO)C1=Cc2cc(OC(F)(F)F)ccc2O[C@@H]1C(F)(F)F.
What is the InChIKey of 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
The InChIKey is CIKYCAWRPDUSRU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H14F6O5/c17-15(18,19)13-11(14(24)25-6-2-1-5-23)8-9-7-10(27-16(20,21)22)3-4-12(9)26-13/h3-4,7-8,13,23H,1-2,5-6H2/t13-/m0/s1.
What are the key properties of 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate?
4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate has a molecular weight of 400.27 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl (2S)-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate is sourced from PubChem (CID 91105278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).