C21H17ClF4O4 — CID 142947334
4-(4-hydroxyphenyl)butyl 6-chloro-7-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 142947334) has the molecular formula C21H17ClF4O4 and a molecular weight of 444.81 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)butyl 6-chloro-7-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 4-(4-hydroxyphenyl)butyl 6-chloro-7-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 142947334 |
| Molecular Formula | C21H17ClF4O4 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4-(4-hydroxyphenyl)butyl 6-chloro-7-fluoro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OCCCCc1ccc(O)cc1)C1=Cc2cc(Cl)c(F)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C21H17ClF4O4/c22-16-10-13-9-15(19(21(24,25)26)30-18(13)11-17(16)23)20(28)29-8-2-1-3-12-4-6-14(27)7-5-12/h4-7,9-11,19,27H,1-3,8H2 |
| InChIKey | SLUCVVZYPLGANW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|