C16H18F4O3Si — CID 141319909
ethyl 8-fluoro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylate (PubChem CID 141319909) has the molecular formula C16H18F4O3Si and a molecular weight of 362.40 g/mol. Its IUPAC name is ethyl 8-fluoro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylate.
| Compound Name | ethyl 8-fluoro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 141319909 |
| Molecular Formula | C16H18F4O3Si |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | ethyl 8-fluoro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc([Si](C)(C)C)cc(F)c2OC1C(F)(F)F |
| InChI | InChI=1S/C16H18F4O3Si/c1-5-22-15(21)11-7-9-6-10(24(2,3)4)8-12(17)13(9)23-14(11)16(18,19)20/h6-8,14H,5H2,1-4H3 |
| InChIKey | VNAJMSNYOJJWFI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|