C17H9Cl2F3O4 — CID 58934514
(2S)-6-chloro-5-(3-chlorophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934514) has the molecular formula C17H9Cl2F3O4 and a molecular weight of 405.16 g/mol. Its IUPAC name is (2S)-6-chloro-5-(3-chlorophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | (2S)-6-chloro-5-(3-chlorophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934514 |
| Molecular Formula | C17H9Cl2F3O4 |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | (2S)-6-chloro-5-(3-chlorophenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2c(ccc(Cl)c2Oc2cccc(Cl)c2)O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C17H9Cl2F3O4/c18-8-2-1-3-9(6-8)25-14-10-7-11(16(23)24)15(17(20,21)22)26-13(10)5-4-12(14)19/h1-7,15H,(H,23,24)/t15-/m0/s1 |
| InChIKey | KJECPBYGEHHQNN-HNNXBMFYSA-N |
| XLogP | 5.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |